cas: 15318-45-3 — see every product listed under this CAS number, including other names
2,2-Dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-[4-(methylsulfonyl)phenyl]ethyl]acetamide, 98%, 98% (CAS 15318-45-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 10g, 15g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HY4Z-5g |
| cas | 15318-45-3 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 227.60 Pln | |
| Chemat | 500g | 926.40 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 15g | 107.60 Pln | |
| Chemat | 50g | 165.20 Pln | |
| Chemat | 75g | 213.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Thiamphenicol is a monocarboxylic acid amide and a sulfone. It has a role as an antimicrobial agent and an immunosuppressive agent.
Source: ChEBI
| Molecular formula | C12H15Cl2NO5S |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| InChIKey | OTVAEFIXJLOWRX-NXEZZACHSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O |
Computed by PubChem (NCBI)