CAS 21079-44-7 is the registry number for Thiamphenicol Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dichloro-N-[(1S,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide (CAS 21079-44-7) is a chemical compound with the molecular formula C12H15Cl2NO5S and a molecular weight of 356.2 g/mol. IUPAC name: 2,2-dichloro-N-[(1S,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide. InChIKey: OTVAEFIXJLOWRX-ZJUUUORDSA-N.
| Molecular formula | C12H15Cl2NO5S |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1S,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| InChIKey | OTVAEFIXJLOWRX-ZJUUUORDSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@@H]([C@@H](CO)NC(=O)C(Cl)Cl)O |
Computed by PubChem (NCBI)