cas: 156021-07-7 — see every product listed under this CAS number, including other names
2,2-Difluoro-1-phenyl-cyclopropanecarboxylic acid 98% (CAS 156021-07-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A616555-250mg |
| cas | 156021-07-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 731.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A616555 |
2,2-difluoro-1-phenylcyclopropane-1-carboxylic acid (CAS 156021-07-7) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 2,2-difluoro-1-phenylcyclopropane-1-carboxylic acid. InChIKey: QXRNDRDZDULUAG-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 2,2-difluoro-1-phenylcyclopropane-1-carboxylic acid |
| InChIKey | QXRNDRDZDULUAG-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)