Products 705250-75-5
CAS 705250-75-5 appears in our catalog under these names: (2E)-3-(3,5-Difluorophenyl)-2-propenoic acid, methyl ester, 95%, (E)-Methyl 3-(3,5-difluorophenyl)acrylate, 95+%, (E)–Methyl 3–(3，5–difluorophenyl)acrylate, Methyl (E)-3-(3,5-difluorophenyl)prop-2-enoate. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg, 2,5g.
Methyl (E)-3-(3,5-difluorophenyl)prop-2-enoate (CAS 705250-75-5) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: methyl (E)-3-(3,5-difluorophenyl)prop-2-enoate. InChIKey: TUXPCMOFNRGWEC-NSCUHMNNSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | methyl (E)-3-(3,5-difluorophenyl)prop-2-enoate |
| InChIKey | TUXPCMOFNRGWEC-NSCUHMNNSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)