cas: 135082-85-8 — see every product listed under this CAS number, including other names
2,2-Dimethyl-2H-chromen-6-amine, 97% (CAS 135082-85-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A478110-5g |
| cas | 135082-85-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14287.84 Pln | |
| AmBeed | 1g | 4262.44 Pln | |
| AmBeed | 10g | 25126.99 Pln | |
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 825.77 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2-dimethylchromen-6-amine (CAS 135082-85-8) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 2,2-dimethylchromen-6-amine. InChIKey: RRJNLKVSQVLBFJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2,2-dimethylchromen-6-amine |
| InChIKey | RRJNLKVSQVLBFJ-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2)N)C |
Computed by PubChem (NCBI)