CAS 135082-85-8 appears in our catalog under these names: 2,2-Dimethyl-2H-chromen-6-amine, 95%, 2,2-Dimethyl-2H-chromen-6-amine, 97%, 2,2–Dimethyl–2H–chromen–6–amine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
2,2-dimethylchromen-6-amine (CAS 135082-85-8) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 2,2-dimethylchromen-6-amine. InChIKey: RRJNLKVSQVLBFJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2,2-dimethylchromen-6-amine |
| InChIKey | RRJNLKVSQVLBFJ-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2)N)C |
Computed by PubChem (NCBI)