cas: 1380307-35-6 — see every product listed under this CAS number, including other names
2,2-Dimethyl-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propan-1-ol 95% (CAS 1380307-35-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A585302-100mg |
| cas | 1380307-35-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1093.50 Pln | |
| Ambeed | 250mg | 2033.56 Pln | |
| Ambeed | 1g | 6094.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A585302 |
2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-ol (CAS 1380307-35-6) is a chemical compound with the molecular formula C14H25BN2O3 and a molecular weight of 280.17 g/mol. IUPAC name: 2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-ol. InChIKey: ZXULSCHHTCWGTB-UHFFFAOYSA-N.
| Molecular formula | C14H25BN2O3 |
|---|---|
| Molecular weight | 280.17 g/mol |
| IUPAC name | 2,2-dimethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-ol |
| InChIKey | ZXULSCHHTCWGTB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(C)(C)CO |
Computed by PubChem (NCBI)