cas: 1246999-33-6 — see every product listed under this CAS number, including other names
2,2-Dimethyl-4-oxo-3,8,11,14-tetraoxa-5-azahexadecan-16-yl 4-methylbenzenesulfonate, 97% (CAS 1246999-33-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867294-1G |
| cas | 1246999-33-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 1127.75 Pln | |
| Fluorochem | 10g | 2080.54 Pln | |
| Fluorochem | 25g | 4090.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 1246999-33-6) is a chemical compound with the molecular formula C20H33NO8S and a molecular weight of 447.5 g/mol. IUPAC name: 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: NWLAEQSWDZYPBV-UHFFFAOYSA-N.
| Molecular formula | C20H33NO8S |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | NWLAEQSWDZYPBV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)