Tos-PEG4-NH-Boc, 98.0%
cas: 1246999-33-6 — see every product listed under this CAS number, including other names
Tos-PEG4-NH-Boc, 98.0% (CAS 1246999-33-6) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 mg, 10 g, 1 g, 5 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-128803-25 g |
| cas | 1246999-33-6 |
| size | 25 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 5395.58 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 10 g | 2423.42 Pln | |
| MedChemExpress | 1 g | 403.28 Pln | |
| MedChemExpress | 5 g | 1341.37 Pln | |
| MedChemExpress | 250 mg | 287.18 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 1246999-33-6) is a chemical compound with the molecular formula C20H33NO8S and a molecular weight of 447.5 g/mol. IUPAC name: 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: NWLAEQSWDZYPBV-UHFFFAOYSA-N.
| Molecular formula | C20H33NO8S |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | NWLAEQSWDZYPBV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)