cas: 86847-77-0 — see every product listed under this CAS number, including other names
2,2-Dimethyl-n-(4-methyl-pyridin-2-yl)-propionamide, >98%, >98% (CAS 86847-77-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IE9B-100mg |
| cas | 86847-77-0 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1163.60 Pln | |
| Chemat | 5g | 2267.60 Pln | |
| Chemat | 10g | 3371.60 Pln | |
| Chemat | 25g | 6611.60 Pln |
| purity | >98% |
|---|---|
| delivery time | 3 weeks |
2,2-dimethyl-N-(4-methyl-2-pyridinyl)propanamide (CAS 86847-77-0) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 2,2-dimethyl-N-(4-methyl-2-pyridinyl)propanamide. InChIKey: GMKUFMYZJOPWSH-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 2,2-dimethyl-N-(4-methyl-2-pyridinyl)propanamide |
| InChIKey | GMKUFMYZJOPWSH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)