cas: 96980-64-2 — see every product listed under this CAS number, including other names
2,3'-Dichloro-4-fluoroacetanilide (CAS 96980-64-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008223-500MG |
| cas | 96980-64-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 128.10 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 2.5g | 206.20 Pln | |
| Fluorochem | 5g | 237.43 Pln |
| delivery time | 2-3 weeks |
|---|
2-chloro-N-(3-chloro-4-fluorophenyl)acetamide (CAS 96980-64-2) is a chemical compound with the molecular formula C8H6Cl2FNO and a molecular weight of 222.04 g/mol. IUPAC name: 2-chloro-N-(3-chloro-4-fluorophenyl)acetamide. InChIKey: DJPAQYXQRCWKEH-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2FNO |
|---|---|
| Molecular weight | 222.04 g/mol |
| IUPAC name | 2-chloro-N-(3-chloro-4-fluorophenyl)acetamide |
| InChIKey | DJPAQYXQRCWKEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CCl)Cl)F |
Computed by PubChem (NCBI)