cas: 96980-64-2 — see every product listed under this CAS number, including other names
2-Chloro-N-(3-chloro-4-fluorophenyl)acetamide, 99%,RG, 99%,RG (CAS 96980-64-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116S0L-1g |
| cas | 96980-64-2 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 25g | 894.80 Pln | |
| Chemat | 250mg | 78.80 Pln |
| purity | 99%,RG |
|---|---|
| delivery time | 3 weeks |
2-chloro-N-(3-chloro-4-fluorophenyl)acetamide (CAS 96980-64-2) is a chemical compound with the molecular formula C8H6Cl2FNO and a molecular weight of 222.04 g/mol. IUPAC name: 2-chloro-N-(3-chloro-4-fluorophenyl)acetamide. InChIKey: DJPAQYXQRCWKEH-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2FNO |
|---|---|
| Molecular weight | 222.04 g/mol |
| IUPAC name | 2-chloro-N-(3-chloro-4-fluorophenyl)acetamide |
| InChIKey | DJPAQYXQRCWKEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CCl)Cl)F |
Computed by PubChem (NCBI)