cas: 50-74-8 — see every product listed under this CAS number, including other names
2,3,4,5-Tetrachlorobenzoic Acid, >97.0%(GC)(T) (CAS 50-74-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2378-5G |
| cas | 50-74-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 133.10 Pln | |
| TCI | 25g | 285.53 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC)(T) |
2,3,4,5-tetrachlorobenzoic acid (CAS 50-74-8) is a chemical compound with the molecular formula C7H2Cl4O2 and a molecular weight of 259.9 g/mol. IUPAC name: 2,3,4,5-tetrachlorobenzoic acid. InChIKey: FUXMTEKFGUWSNC-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl4O2 |
|---|---|
| Molecular weight | 259.9 g/mol |
| IUPAC name | 2,3,4,5-tetrachlorobenzoic acid |
| InChIKey | FUXMTEKFGUWSNC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)