CAS 50-74-8 appears in our catalog under these names: 2,3,4,5-Tetrachlorobenzoic acid, 97%, 2,3,4,5-Tetrachlorobenzoic Acid, 98%, 2,3,4,5–Tetrachlorobenzoic Acid, 2,3,4,5-Tetrachlorobenzoic Acid, >97.0%(GC)(T), 2,3,4,5-Tetrachlorobenzoic acid, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 100g, 500g, 5g, 25g, 1g.
2,3,4,5-tetrachlorobenzoic acid (CAS 50-74-8) is a chemical compound with the molecular formula C7H2Cl4O2 and a molecular weight of 259.9 g/mol. IUPAC name: 2,3,4,5-tetrachlorobenzoic acid. InChIKey: FUXMTEKFGUWSNC-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl4O2 |
|---|---|
| Molecular weight | 259.9 g/mol |
| IUPAC name | 2,3,4,5-tetrachlorobenzoic acid |
| InChIKey | FUXMTEKFGUWSNC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)