cas: 879-39-0 — see every product listed under this CAS number, including other names
2,3,4,5-Tetrachloronitrobenzene 97% (CAS 879-39-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A651723-250mg |
| cas | 879-39-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A651723 |
1,2,3,4-tetrachloro-5-nitrobenzene (CAS 879-39-0) is a chemical compound with the molecular formula C6HCl4NO2 and a molecular weight of 260.9 g/mol. IUPAC name: 1,2,3,4-tetrachloro-5-nitrobenzene. InChIKey: MTBYTWZDRVOMBR-UHFFFAOYSA-N.
| Molecular formula | C6HCl4NO2 |
|---|---|
| Molecular weight | 260.9 g/mol |
| IUPAC name | 1,2,3,4-tetrachloro-5-nitrobenzene |
| InChIKey | MTBYTWZDRVOMBR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)