CAS 19340-26-2 appears in our catalog under these names: 2,3,5,6–Tetrachloroisonicotinic acid, 2,3,5,6-TETRACHLOROPYRIDINE-4-CARBOXYLIC ACID, 98%, 98%, 2,3,5,6-Tetrachloroisonicotinic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,3,5,6-tetrachloropyridine-4-carboxylic acid (CAS 19340-26-2) is a chemical compound with the molecular formula C6HCl4NO2 and a molecular weight of 260.9 g/mol. IUPAC name: 2,3,5,6-tetrachloropyridine-4-carboxylic acid. InChIKey: FNZSPKURESXAII-UHFFFAOYSA-N.
| Molecular formula | C6HCl4NO2 |
|---|---|
| Molecular weight | 260.9 g/mol |
| IUPAC name | 2,3,5,6-tetrachloropyridine-4-carboxylic acid |
| InChIKey | FNZSPKURESXAII-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)