cas: 92052-29-4 — see every product listed under this CAS number, including other names
2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl trichloroacetimidate (CAS 92052-29-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM91120C-10g |
| cas | 92052-29-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 7887.87 Pln | |
| Chemat | 1g | 1731.66 Pln | |
| Chemat | 2g | 2615.85 Pln | |
| Chemat | 5g | 4846.32 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (CAS 92052-29-4) is a chemical compound with the molecular formula C16H20Cl3NO10 and a molecular weight of 492.7 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate. InChIKey: IBUZGVQIKARDAF-RGDJUOJXSA-N.
| Molecular formula | C16H20Cl3NO10 |
|---|---|
| Molecular weight | 492.7 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| InChIKey | IBUZGVQIKARDAF-RGDJUOJXSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=N)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)