cas: 92052-29-4 — see every product listed under this CAS number, including other names
2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranosyl 2,2,2-Trichloroacetimidate, 95%, 95% (CAS 92052-29-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147PW-100mg |
| cas | 92052-29-4 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (CAS 92052-29-4) is a chemical compound with the molecular formula C16H20Cl3NO10 and a molecular weight of 492.7 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate. InChIKey: IBUZGVQIKARDAF-RGDJUOJXSA-N.
| Molecular formula | C16H20Cl3NO10 |
|---|---|
| Molecular weight | 492.7 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| InChIKey | IBUZGVQIKARDAF-RGDJUOJXSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=N)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)