cas: 53001-70-0 — see every product listed under this CAS number, including other names
2,3,4,6-Tetrafluorobenzyl Alcohol (CAS 53001-70-0) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FDS-200mg |
| cas | 53001-70-0 |
| size | 200mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 150.80 Pln | |
| Chemat | 1g | 184.40 Pln |
| delivery time | 3 weeks |
|---|
(2,3,4,6-tetrafluorophenyl)methanol (CAS 53001-70-0) is a chemical compound with the molecular formula C7H4F4O and a molecular weight of 180.10 g/mol. IUPAC name: (2,3,4,6-tetrafluorophenyl)methanol. InChIKey: BXLQTYVTBJQPPZ-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | (2,3,4,6-tetrafluorophenyl)methanol |
| InChIKey | BXLQTYVTBJQPPZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)CO)F |
Computed by PubChem (NCBI)