CAS 219581-07-4 appears in our catalog under these names: 3-Fluoro-4-(trifluoromethyl)phenol, 3-Fluoro-4-(trifluoromethyl)phenol, 97%, 3-Fluoro-4-(trifluoromethyl)phenol 95%. Offered by: Fluorochem, Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-fluoro-4-(trifluoromethyl)phenol (CAS 219581-07-4) is a chemical compound with the molecular formula C7H4F4O and a molecular weight of 180.10 g/mol. IUPAC name: 3-fluoro-4-(trifluoromethyl)phenol. InChIKey: XTLJKHBPNDOAGE-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 3-fluoro-4-(trifluoromethyl)phenol |
| InChIKey | XTLJKHBPNDOAGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)C(F)(F)F |
Computed by PubChem (NCBI)