cas: 207919-09-3 — see every product listed under this CAS number, including other names
2,3,4-Trifluorobenzamide 97% (CAS 207919-09-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A689136-100g |
| cas | 207919-09-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 2439.62 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 698.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A689136 |
2,3,4-trifluorobenzamide (CAS 207919-09-3) is a chemical compound with the molecular formula C7H4F3NO and a molecular weight of 175.11 g/mol. IUPAC name: 2,3,4-trifluorobenzamide. InChIKey: XGOGYOBKQVLGAY-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO |
|---|---|
| Molecular weight | 175.11 g/mol |
| IUPAC name | 2,3,4-trifluorobenzamide |
| InChIKey | XGOGYOBKQVLGAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)N)F)F)F |
Computed by PubChem (NCBI)