cas: 19340-26-2 — see every product listed under this CAS number, including other names
2,3,5,6-TETRACHLOROPYRIDINE-4-CARBOXYLIC ACID, 98%, 98% (CAS 19340-26-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AKGU-100mg |
| cas | 19340-26-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 659.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3,5,6-tetrachloropyridine-4-carboxylic acid (CAS 19340-26-2) is a chemical compound with the molecular formula C6HCl4NO2 and a molecular weight of 260.9 g/mol. IUPAC name: 2,3,5,6-tetrachloropyridine-4-carboxylic acid. InChIKey: FNZSPKURESXAII-UHFFFAOYSA-N.
| Molecular formula | C6HCl4NO2 |
|---|---|
| Molecular weight | 260.9 g/mol |
| IUPAC name | 2,3,5,6-tetrachloropyridine-4-carboxylic acid |
| InChIKey | FNZSPKURESXAII-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)