cas: 24336-73-0 — see every product listed under this CAS number, including other names
2,3,5,6-Tetrafluoro-4-hydroxybenzaldehyde 97% (CAS 24336-73-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A240071-250mg |
| cas | 24336-73-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 843.19 Pln | |
| Ambeed | 5g | 2400.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A240071 |
2,3,5,6-tetrafluoro-4-hydroxybenzaldehyde (CAS 24336-73-0) is a chemical compound with the molecular formula C7H2F4O2 and a molecular weight of 194.08 g/mol. IUPAC name: 2,3,5,6-tetrafluoro-4-hydroxybenzaldehyde. InChIKey: TVPXYVRDACHTAD-UHFFFAOYSA-N.
| Molecular formula | C7H2F4O2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 2,3,5,6-tetrafluoro-4-hydroxybenzaldehyde |
| InChIKey | TVPXYVRDACHTAD-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(C(=C(C(=C1F)F)O)F)F |
Computed by PubChem (NCBI)