cas: 24336-73-0 — see every product listed under this CAS number, including other names
2,3,5,6-tetrafluoro-4-hydroxybenzaldehyde, 97%, 97% (CAS 24336-73-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C2A4-250mg |
| cas | 24336-73-0 |
| size | 250mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 923.60 Pln | |
| Chemat | 5g | 2646.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3,5,6-tetrafluoro-4-hydroxybenzaldehyde (CAS 24336-73-0) is a chemical compound with the molecular formula C7H2F4O2 and a molecular weight of 194.08 g/mol. IUPAC name: 2,3,5,6-tetrafluoro-4-hydroxybenzaldehyde. InChIKey: TVPXYVRDACHTAD-UHFFFAOYSA-N.
| Molecular formula | C7H2F4O2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 2,3,5,6-tetrafluoro-4-hydroxybenzaldehyde |
| InChIKey | TVPXYVRDACHTAD-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(C(=C(C(=C1F)F)O)F)F |
Computed by PubChem (NCBI)