CAS 142685-25-4 appears in our catalog under these names: 2,3,5,6-Tetrafluorophenyl 2,2,2-trifluoroacetate, 98%, 98%, 2,3,5,6-Tetrafluorophenyl trifluoroacetate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g.
(2,3,5,6-tetrafluorophenyl) 2,2,2-trifluoroacetate (CAS 142685-25-4) is a chemical compound with the molecular formula C8HF7O2 and a molecular weight of 262.08 g/mol. IUPAC name: (2,3,5,6-tetrafluorophenyl) 2,2,2-trifluoroacetate. InChIKey: OJLSSULCTKBVOB-UHFFFAOYSA-N.
| Molecular formula | C8HF7O2 |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | (2,3,5,6-tetrafluorophenyl) 2,2,2-trifluoroacetate |
| InChIKey | OJLSSULCTKBVOB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)OC(=O)C(F)(F)F)F)F |
Computed by PubChem (NCBI)