CAS 91407-89-5 is the registry number for 2,2-Difluoro-2-(perfluorophenyl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid (CAS 91407-89-5) is a chemical compound with the molecular formula C8HF7O2 and a molecular weight of 262.08 g/mol. IUPAC name: 2,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid. InChIKey: SRWQZLPAWBOLJD-UHFFFAOYSA-N.
| Molecular formula | C8HF7O2 |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | 2,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid |
| InChIKey | SRWQZLPAWBOLJD-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)