Products 91407-89-5

CAS 91407-89-5 is the registry number for 2,2-Difluoro-2-(perfluorophenyl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid (CAS 91407-89-5) is a chemical compound with the molecular formula C8HF7O2 and a molecular weight of 262.08 g/mol. IUPAC name: 2,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid. InChIKey: SRWQZLPAWBOLJD-UHFFFAOYSA-N.

Identity
Molecular formulaC8HF7O2
Molecular weight262.08 g/mol
IUPAC name2,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)acetic acid
InChIKeySRWQZLPAWBOLJD-UHFFFAOYSA-N
SMILESC1(=C(C(=C(C(=C1F)F)F)F)F)C(C(=O)O)(F)F

Computed by PubChem (NCBI)