cas: 60706-63-0 — see every product listed under this CAS number, including other names
2,3,5,6-Tetramethylbenzene-1-sulfonyl chloride 98% (CAS 60706-63-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144755-1g |
| cas | 60706-63-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 25g | 409.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A144755 |
2,3,5,6-tetramethylbenzenesulfonyl chloride (CAS 60706-63-0) is a chemical compound with the molecular formula C10H13ClO2S and a molecular weight of 232.73 g/mol. IUPAC name: 2,3,5,6-tetramethylbenzenesulfonyl chloride. InChIKey: ZCXRROBIIMQMHR-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO2S |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 2,3,5,6-tetramethylbenzenesulfonyl chloride |
| InChIKey | ZCXRROBIIMQMHR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)Cl)C)C |
Computed by PubChem (NCBI)