CAS 60706-63-0 appears in our catalog under these names: 2,3,5,6-Tetramethylbenzenesulfonyl chloride, 98%, 2,3,5,6-Tetramethylbenzenesulfonyl chloride/ 98%, 2,3,5,6-Tetramethylbenzenesulfonyl chloride, 98% , 2,3,5,6-Tetramethylbenzenesulfonyl chloride, 2,3,5,6-Tetramethylbenzene-1-sulfonyl chloride, 98%, 98%. Offered by: Combi-blocks, Chemat, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 50g, 2,5g, 0,25g.
2,3,5,6-tetramethylbenzenesulfonyl chloride (CAS 60706-63-0) is a chemical compound with the molecular formula C10H13ClO2S and a molecular weight of 232.73 g/mol. IUPAC name: 2,3,5,6-tetramethylbenzenesulfonyl chloride. InChIKey: ZCXRROBIIMQMHR-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO2S |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 2,3,5,6-tetramethylbenzenesulfonyl chloride |
| InChIKey | ZCXRROBIIMQMHR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)Cl)C)C |
Computed by PubChem (NCBI)