Products 1201-31-6
CAS 1201-31-6 appears in our catalog under these names: Moxifloxacin Impurity 60, 2,3,4,5-Tetrafluorobenzoic acid, 2,3,4,5–Tetrafluorobenzoic Acid, 2,3,4,5-Tetrafluorobenzoic Acid, >98.0%(HPLC)(T), 2,3,4,5-Tetrafluorobenzoic acid 95%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, TCI. Available pack sizes: on request, 5g, 100g, 500g, 5000g, 1000g, 25g, 10000g.
2,3,4,5-tetrafluorobenzoic acid (CAS 1201-31-6) is a chemical compound with the molecular formula C7H2F4O2 and a molecular weight of 194.08 g/mol. IUPAC name: 2,3,4,5-tetrafluorobenzoic acid. InChIKey: SFKRXQKJTIYUAG-UHFFFAOYSA-N.
| Molecular formula | C7H2F4O2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 2,3,4,5-tetrafluorobenzoic acid |
| InChIKey | SFKRXQKJTIYUAG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,3,4,5-Tetrafluorobenzoic acid, Benzoic acid, 2,3,4,5-tetrafluoro-, 2,3,4,5-tetra FBA, 2,3,4,5-tetrafluoro benzoic acid, 2,3,4,5-Tetrafluorobenzoicacid, Benzoic acid, tetrafluoro-, 2,3,4,5-Tetrafluorobezoic acid, Tetrafluorobenzoic acid, 2,3,4,5-Tetrafluorobenzoic, SFKRXQKJTIYUAG-UHFFFAOYSA-