cas: 1228665-98-2 — see every product listed under this CAS number, including other names
2,3-Bis(benzyloxy)pyridine, 95+% (CAS 1228665-98-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A139582-1g |
| cas | 1228665-98-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 22067.29 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-bis(phenylmethoxy)pyridine (CAS 1228665-98-2) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: 2,3-bis(phenylmethoxy)pyridine. InChIKey: FKBLXSTVQUPYIR-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 2,3-bis(phenylmethoxy)pyridine |
| InChIKey | FKBLXSTVQUPYIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)