Products 436089-41-7
CAS 436089-41-7 appears in our catalog under these names: 6,8-Dimethyl-2-(4-methylphenyl)quinoline-4-carboxylic acid, 95%, 6,8-Dimethyl-2-(p-tolyl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylic acid (CAS 436089-41-7) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylic acid. InChIKey: URBOZCFEPSTTKH-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylic acid |
| InChIKey | URBOZCFEPSTTKH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3C(=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)