CAS 13755-95-8 appears in our catalog under these names: 2,3-Diamino-1,4-naphthalenedione, 95%, 95%, 2,3-Diaminonaphthalene-1,4-dione, 95%, 2,3–Diaminonaphthalene–1,4–dione. Offered by: Chemat, Fluorochem, GLPBio. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
2,3-diaminonaphthalene-1,4-dione (CAS 13755-95-8) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 2,3-diaminonaphthalene-1,4-dione. InChIKey: YGFBBXYYCLHOOW-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2,3-diaminonaphthalene-1,4-dione |
| InChIKey | YGFBBXYYCLHOOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C2=O)N)N |
Computed by PubChem (NCBI)