CAS 103505-54-0 appears in our catalog under these names: 6,6'-Dihydroxy-2,2'-bipyridyl, 95%, [2,2'-Bipyridine]-6,6'(1h,1'h)-dione, 95%, (2,2'–Bipyridine)–6,6'(1H,1'H)–dione, 2,2'-Bipyridine-6,6'-diol, >98.0%(GC)(T), 2,2'-Bipyridine-6,6'-(1H,1'H)dione. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 25g, 10g, 250mg, 500mg, 1000mg, 2000mg.
6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one (CAS 103505-54-0) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one. InChIKey: POJMWJLYXGXUNU-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one |
| InChIKey | POJMWJLYXGXUNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC(=C1)C2=CC=CC(=O)N2 |
Computed by PubChem (NCBI)