CAS 6287-82-7 appears in our catalog under these names: 2,3–Dibromobenzo(b)thiophene, 2,3-Dibromobenzo[b]thiophene, >98.0%(GC), 2,3-DIBROMOBENZO(B)THIOPHENE, 97%, 2,3-Dibromobenzo[b]thiophene, 98%. Offered by: GLPBio, TCI, Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
2,3-dibromo-1-benzothiophene (CAS 6287-82-7) is a chemical compound with the molecular formula C8H4Br2S and a molecular weight of 291.99 g/mol. IUPAC name: 2,3-dibromo-1-benzothiophene. InChIKey: TWZSIAFEFBKCNN-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2S |
|---|---|
| Molecular weight | 291.99 g/mol |
| IUPAC name | 2,3-dibromo-1-benzothiophene |
| InChIKey | TWZSIAFEFBKCNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)Br)Br |
Computed by PubChem (NCBI)