CAS 1473425-58-9 is the registry number for 4,7–Dibromobenzo(c)thiophene. Offered by: GLPBio. Available pack sizes: 5g.
4,7-dibromo-2-benzothiophene (CAS 1473425-58-9) is a chemical compound with the molecular formula C8H4Br2S and a molecular weight of 291.99 g/mol. IUPAC name: 4,7-dibromo-2-benzothiophene. InChIKey: DPKFDNLBAPZRMM-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2S |
|---|---|
| Molecular weight | 291.99 g/mol |
| IUPAC name | 4,7-dibromo-2-benzothiophene |
| InChIKey | DPKFDNLBAPZRMM-UHFFFAOYSA-N |
| SMILES | C1=C(C2=CSC=C2C(=C1)Br)Br |
Computed by PubChem (NCBI)