cas: 1806282-06-3 — see every product listed under this CAS number, including other names
2,3-Dichloro-6-hydroxybenzoic acid, 97% (CAS 1806282-06-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A216540-5g |
| cas | 1806282-06-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10564.12 Pln | |
| AmBeed | 10g | 17926.93 Pln | |
| AmBeed | 25g | 35191.45 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-dichloro-6-hydroxybenzoic acid (CAS 1806282-06-3) is a chemical compound with the molecular formula C7H4Cl2O3 and a molecular weight of 207.01 g/mol. IUPAC name: 2,3-dichloro-6-hydroxybenzoic acid. InChIKey: WMDBBJGLXDJZRY-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O3 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,3-dichloro-6-hydroxybenzoic acid |
| InChIKey | WMDBBJGLXDJZRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)