Products 91658-93-4

CAS 91658-93-4 appears in our catalog under these names: 2,4-Dichloro-3-hydroxybenzoic acid, 95%, 2,4-Dichloro-3-hydroxybenzoic acid, 97%, 97%, 2,4-Dichloro-3-hydroxybenzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-3-hydroxybenzoic acid (CAS 91658-93-4) is a chemical compound with the molecular formula C7H4Cl2O3 and a molecular weight of 207.01 g/mol. IUPAC name: 2,4-dichloro-3-hydroxybenzoic acid. InChIKey: PWYTVCDAONKNGR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4Cl2O3
Molecular weight207.01 g/mol
IUPAC name2,4-dichloro-3-hydroxybenzoic acid
InChIKeyPWYTVCDAONKNGR-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)Cl)O)Cl

Computed by PubChem (NCBI)