cas: 4519-39-5 — see every product listed under this CAS number, including other names
2,3-Difluorobenzoic acid, 98%, 98% (CAS 4519-39-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9HW-1g |
| cas | 4519-39-5 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 395.60 Pln | |
| Chemat | 500g | 1795.20 Pln | |
| Chemat | 1kg | 3506.00 Pln | |
| Chemat | 5kg | 10800.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-difluorobenzoic acid (CAS 4519-39-5) is a chemical compound with the molecular formula C7H4F2O2 and a molecular weight of 158.10 g/mol. IUPAC name: 2,3-difluorobenzoic acid. InChIKey: JLZVIWSFUPLSOR-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O2 |
|---|---|
| Molecular weight | 158.10 g/mol |
| IUPAC name | 2,3-difluorobenzoic acid |
| InChIKey | JLZVIWSFUPLSOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)