CAS 4519-39-5 appears in our catalog under these names: 2,3-Difluoro Benzoic Acid, 2,3–Difluorobenzoic Acid, 2,3-Difluorobenzoic acid, 98% , 2,3-Difluorobenzoic Acid, >98.0%(GC)(T), 2,3-Difluorobenzoic acid 97%. Offered by: Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: on request, 100g, 25g, 5g, 1g, 500g, 1000g, 10G.
2,3-difluorobenzoic acid (CAS 4519-39-5) is a chemical compound with the molecular formula C7H4F2O2 and a molecular weight of 158.10 g/mol. IUPAC name: 2,3-difluorobenzoic acid. InChIKey: JLZVIWSFUPLSOR-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O2 |
|---|---|
| Molecular weight | 158.10 g/mol |
| IUPAC name | 2,3-difluorobenzoic acid |
| InChIKey | JLZVIWSFUPLSOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)