2,3-Dihydrobenzo[b][1,4]dioxine-6,7-diamine, 97%
cas: 81927-47-1 — see every product listed under this CAS number, including other names
2,3-Dihydrobenzo[b][1,4]dioxine-6,7-diamine, 97% (CAS 81927-47-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A326955-100mg |
| cas | 81927-47-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1060.12 Pln | |
| Ambeed | 5g | 3607.75 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 2042.00 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 597.59 Pln | |
| BLDpharm | 1g | 1136.29 Pln | |
| BLDpharm | 5g | 3885.32 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2,3-dihydro-1,4-benzodioxine-6,7-diamine (CAS 81927-47-1) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-6,7-diamine. InChIKey: FJRUWRJAJNEIKD-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-6,7-diamine |
| InChIKey | FJRUWRJAJNEIKD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)N)N |
Computed by PubChem (NCBI)
Synonyms:
1,2-Diamino-4,5-ethylenedioxybenzene, DEDB, 2,3-Dihydro-1,4-benzodioxine-6,7-diamine, 2,3-dihydrobenzo[b][1,4]dioxine-6,7-diamine, 2,3-Dihydro-1,4-benzodioxin-6,7-diamine, 1,4-Benzodioxin-6,7-diamine, 2,3-dihydro-, 2,3-Dihydro-1,4-benzodioxine-6,7-diamine #, Benzo[b]1,4-dioxine-6,7-diamine, 2,3-dihydro-, 1,4-benzodioxin-6,7-diamine, 2,3-dihydro-, dihydrochloride, 2,3-dihydr