Products 1556315-73-1
CAS 1556315-73-1 appears in our catalog under these names: 4H,5H,6H,7H-pyrazolo[1,5-a]pyridine-7-carboxylic acid, 95%, 4,5,6,7-Tetrahydropyrazolo(1,5-a)pyridine-7-carboxylic acid, 98%, 4H,5H,6H,7H-Pyrazolo(1,5-a)pyridine-7-carboxylic acid, 4,5,6,7-Tetrahydropyrazolo[1,5-a]pyridine-7-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-7-carboxylic acid (CAS 1556315-73-1) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-7-carboxylic acid. InChIKey: AZTZOVYXLBVKMO-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-7-carboxylic acid |
| InChIKey | AZTZOVYXLBVKMO-UHFFFAOYSA-N |
| SMILES | C1CC(N2C(=CC=N2)C1)C(=O)O |
Computed by PubChem (NCBI)