cas: 112822-85-2 — see every product listed under this CAS number, including other names
2,4,5-Trifluoro-3-methylbenzoic acid, 97% (CAS 112822-85-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079725-250MG |
| cas | 112822-85-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 612.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,4,5-trifluoro-3-methylbenzoic acid (CAS 112822-85-2) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methylbenzoic acid. InChIKey: CISXRFRLKWCFJS-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methylbenzoic acid |
| InChIKey | CISXRFRLKWCFJS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1F)F)C(=O)O)F |
Computed by PubChem (NCBI)