CAS 112822-85-2 appears in our catalog under these names: 3-Methyl-2,4,5-trifluorobenzoic acid, 95%, 3-Methyl-2,4,5-trifluorobenzoic acid, 3-Methyl-2,4,5-trifluorobenzoic acid, 97%, 97%, 2,4,5-Trifluoro-3-methylbenzoic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 50g, 250mg.
2,4,5-trifluoro-3-methylbenzoic acid (CAS 112822-85-2) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methylbenzoic acid. InChIKey: CISXRFRLKWCFJS-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methylbenzoic acid |
| InChIKey | CISXRFRLKWCFJS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1F)F)C(=O)O)F |
Computed by PubChem (NCBI)