cas: 287172-63-8 — see every product listed under this CAS number, including other names
2,4,5-Trifluorobenzenesulfonamide (CAS 287172-63-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005527-1G |
| cas | 287172-63-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 706.02 Pln | |
| Fluorochem | 10g | 950.72 Pln |
| delivery time | 2-3 weeks |
|---|
2,4,5-trifluorobenzenesulfonamide (CAS 287172-63-8) is a chemical compound with the molecular formula C6H4F3NO2S and a molecular weight of 211.16 g/mol. IUPAC name: 2,4,5-trifluorobenzenesulfonamide. InChIKey: DJZNADBWJLAUPG-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2S |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | 2,4,5-trifluorobenzenesulfonamide |
| InChIKey | DJZNADBWJLAUPG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)S(=O)(=O)N)F)F |
Computed by PubChem (NCBI)