CAS 79247-85-1 is the registry number for Methyl 4-(trifluoromethyl)thiazole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-(trifluoromethyl)-1,3-thiazole-2-carboxylate (CAS 79247-85-1) is a chemical compound with the molecular formula C6H4F3NO2S and a molecular weight of 211.16 g/mol. IUPAC name: methyl 4-(trifluoromethyl)-1,3-thiazole-2-carboxylate. InChIKey: BQJHXOYYMRJRKL-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2S |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | methyl 4-(trifluoromethyl)-1,3-thiazole-2-carboxylate |
| InChIKey | BQJHXOYYMRJRKL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=CS1)C(F)(F)F |
Computed by PubChem (NCBI)