cas: 5400-76-0 — see every product listed under this CAS number, including other names
2,4,6-Trichloro-3-methylaniline 97% (CAS 5400-76-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A941534-5g |
| cas | 5400-76-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 303.62 Pln | |
| Ambeed | 25g | 654.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A941534 |
2,4,6-trichloro-3-methylaniline (CAS 5400-76-0) is a chemical compound with the molecular formula C7H6Cl3N and a molecular weight of 210.5 g/mol. IUPAC name: 2,4,6-trichloro-3-methylaniline. InChIKey: ZPDXEMXEUWPXSP-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3N |
|---|---|
| Molecular weight | 210.5 g/mol |
| IUPAC name | 2,4,6-trichloro-3-methylaniline |
| InChIKey | ZPDXEMXEUWPXSP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1Cl)Cl)N)Cl |
Computed by PubChem (NCBI)