cas: 5400-76-0 — see every product listed under this CAS number, including other names
2,4,6-Trichloro-3-methylbenzenamine, 98%, 98% (CAS 5400-76-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E1ZB-1g |
| cas | 5400-76-0 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 10g | 275.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4,6-trichloro-3-methylaniline (CAS 5400-76-0) is a chemical compound with the molecular formula C7H6Cl3N and a molecular weight of 210.5 g/mol. IUPAC name: 2,4,6-trichloro-3-methylaniline. InChIKey: ZPDXEMXEUWPXSP-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3N |
|---|---|
| Molecular weight | 210.5 g/mol |
| IUPAC name | 2,4,6-trichloro-3-methylaniline |
| InChIKey | ZPDXEMXEUWPXSP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1Cl)Cl)N)Cl |
Computed by PubChem (NCBI)