cas: 2012-31-9 — see every product listed under this CAS number, including other names
2,4,6-Triiodobenzoic acid (CAS 2012-31-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM04650W-100mg |
| cas | 2012-31-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1202.41 Pln | |
| Chemat | 500mg | 4423.71 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
2,4,6-triiodobenzoic acid (CAS 2012-31-9) is a chemical compound with the molecular formula C7H3I3O2 and a molecular weight of 499.81 g/mol. IUPAC name: 2,4,6-triiodobenzoic acid. InChIKey: CRVYPNHLIAWRNV-UHFFFAOYSA-N.
| Molecular formula | C7H3I3O2 |
|---|---|
| Molecular weight | 499.81 g/mol |
| IUPAC name | 2,4,6-triiodobenzoic acid |
| InChIKey | CRVYPNHLIAWRNV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)C(=O)O)I)I |
Computed by PubChem (NCBI)