CAS 2012-31-9 appears in our catalog under these names: 2,4,6-Triiodobenzoic acid, 95%, 2,4,6-Triiodobenzoic acid, 97%, 2,4,6-Triiodobenzoic acid. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2,4,6-triiodobenzoic acid (CAS 2012-31-9) is a chemical compound with the molecular formula C7H3I3O2 and a molecular weight of 499.81 g/mol. IUPAC name: 2,4,6-triiodobenzoic acid. InChIKey: CRVYPNHLIAWRNV-UHFFFAOYSA-N.
| Molecular formula | C7H3I3O2 |
|---|---|
| Molecular weight | 499.81 g/mol |
| IUPAC name | 2,4,6-triiodobenzoic acid |
| InChIKey | CRVYPNHLIAWRNV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)C(=O)O)I)I |
Computed by PubChem (NCBI)