2,4,6-Trimethoxybenzylamine hydrochloride, 98%
cas: 146548-59-6 — see every product listed under this CAS number, including other names
2,4,6-Trimethoxybenzylamine hydrochloride, 98% (CAS 146548-59-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A733354-250mg |
| cas | 146548-59-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2222.69 Pln | |
| Ambeed | 10g | 3735.69 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 2032.40 Pln | |
| Chemat | 10g | 3870.80 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2396.96 Pln | |
| BLDpharm | 10g | 4029.72 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2,4,6-trimethoxyphenyl)methanamine;hydrochloride (CAS 146548-59-6) is a chemical compound with the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. IUPAC name: (2,4,6-trimethoxyphenyl)methanamine;hydrochloride. InChIKey: BLFRMOOGAICNSZ-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | (2,4,6-trimethoxyphenyl)methanamine;hydrochloride |
| InChIKey | BLFRMOOGAICNSZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)CN)OC.Cl |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-Trimethoxybenzylamine hydrochloride, (2,4,6-Trimethoxyphenyl)Methanamine Hydrochloride, 1-(2,4,6-trimethoxyphenyl)methanamine hydrochloride, (2,4,6-trimethoxyphenyl)methanamine;hydrochloride, 2, 4, 6-Trimethoxybenzylamine hydrochloride, 1-(2,4,6-Trimethoxyphenyl)methanamine--hydrogen chloride (1/1), 2,4,6-trimethoxybenzylamine HCl, Benzenemethanamine, 2,4,6-trimethoxy-, hydrochloride, 1-(2,4,6-trimethoxyphenyl)methanam, 1-(2,4,6-Trimethoxyphenyl)methanamine HCl